C18H24ClIN4O2S — CID 109420915
3-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109420915) has the molecular formula C18H24ClIN4O2S and a molecular weight of 522.84 g/mol. Its IUPAC name is 3-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109420915 |
| Molecular Formula | C18H24ClIN4O2S |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | 3-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(Cl)c2c(c1)OCCCO2)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C18H23ClN4O2S.HI/c1-12-22-14(11-26-12)10-23(3)18(20-2)21-9-13-7-15(19)17-16(8-13)24-5-4-6-25-17;/h7-8,11H,4-6,9-10H2,1-3H3,(H,20,21);1H |
| InChIKey | DBEDRZVMCJQPPY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|