C17H22ClIN4O2S — CID 109422939
3-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109422939) has the molecular formula C17H22ClIN4O2S and a molecular weight of 508.81 g/mol. Its IUPAC name is 3-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109422939 |
| Molecular Formula | C17H22ClIN4O2S |
| Molecular Weight | 508.81 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 3-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(Cl)c2c(c1)OCCO2)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C17H21ClN4O2S.HI/c1-11-21-13(10-25-11)9-22(3)17(19-2)20-8-12-6-14(18)16-15(7-12)23-4-5-24-16;/h6-7,10H,4-5,8-9H2,1-3H3,(H,19,20);1H |
| InChIKey | DDANQKLMIZBASD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.81 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|