C19H30N3O13P — CID 158126400
(1-methyltriazol-4-yl)methyl 4-[2-[4-[2,3-diformyloxypropoxy(hydroxy)phosphoryl]oxybutanoyloxy]ethoxy]butanoate (PubChem CID 158126400) has the molecular formula C19H30N3O13P and a molecular weight of 539.43 g/mol. Its IUPAC name is (1-methyltriazol-4-yl)methyl 4-[2-[4-[2,3-diformyloxypropoxy(hydroxy)phosphoryl]oxybutanoyloxy]ethoxy]butanoate.
| Compound Name | (1-methyltriazol-4-yl)methyl 4-[2-[4-[2,3-diformyloxypropoxy(hydroxy)phosphoryl]oxybutanoyloxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 158126400 |
| Molecular Formula | C19H30N3O13P |
| Molecular Weight | 539.43 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | (1-methyltriazol-4-yl)methyl 4-[2-[4-[2,3-diformyloxypropoxy(hydroxy)phosphoryl]oxybutanoyloxy]ethoxy]butanoate |
| SMILES | Cn1cc(COC(=O)CCCOCCOC(=O)CCCOP(=O)(O)OCC(COC=O)OC=O)nn1 |
| InChI | InChI=1S/C19H30N3O13P/c1-22-10-16(20-21-22)11-32-19(26)4-2-6-29-8-9-31-18(25)5-3-7-34-36(27,28)35-13-17(33-15-24)12-30-14-23/h10,14-15,17H,2-9,11-13H2,1H3,(H,27,28) |
| InChIKey | MGNCAXKTVQXCRH-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 200.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.43 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|