C15H32N4O4 — CID 176965815
ethane;2-[2-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (PubChem CID 176965815) has the molecular formula C15H32N4O4 and a molecular weight of 332.45 g/mol. Its IUPAC name is ethane;2-[2-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine.
| Compound Name | ethane;2-[2-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 176965815 |
| Molecular Formula | C15H32N4O4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | ethane;2-[2-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| SMILES | CC.Cc1cn(CCOCCOCCOCCOCCN)nn1 |
| InChI | InChI=1S/C13H26N4O4.C2H6/c1-13-12-17(16-15-13)3-5-19-7-9-21-11-10-20-8-6-18-4-2-14;1-2/h12H,2-11,14H2,1H3;1-2H3 |
| InChIKey | FUQMWEZYZRKQQH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|