C15H28N6O3S — CID 26403188
1-[2-[(2S)-1-(dimethylsulfamoyl)piperidin-2-yl]ethyl]-N-propan-2-yltriazole-4-carboxamide (PubChem CID 26403188) has the molecular formula C15H28N6O3S and a molecular weight of 372.50 g/mol. Its IUPAC name is 1-[2-[(2S)-1-(dimethylsulfamoyl)piperidin-2-yl]ethyl]-N-propan-2-yltriazole-4-carboxamide.
| Compound Name | 1-[2-[(2S)-1-(dimethylsulfamoyl)piperidin-2-yl]ethyl]-N-propan-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 26403188 |
| Molecular Formula | C15H28N6O3S |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-[2-[(2S)-1-(dimethylsulfamoyl)piperidin-2-yl]ethyl]-N-propan-2-yltriazole-4-carboxamide |
| SMILES | CC(C)NC(=O)c1cn(CC[C@@H]2CCCCN2S(=O)(=O)N(C)C)nn1 |
| InChI | InChI=1S/C15H28N6O3S/c1-12(2)16-15(22)14-11-20(18-17-14)10-8-13-7-5-6-9-21(13)25(23,24)19(3)4/h11-13H,5-10H2,1-4H3,(H,16,22)/t13-/m0/s1 |
| InChIKey | NHCLRAKOOKUUNJ-ZDUSSCGKSA-N |
| XLogP | 0.47 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |