C23H31N5O3 — CID 26341710
1-[2-[(2R)-1-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]piperidin-2-yl]ethyl]-N-propan-2-yltriazole-4-carboxamide (PubChem CID 26341710) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 1-[2-[(2R)-1-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]piperidin-2-yl]ethyl]-N-propan-2-yltriazole-4-carboxamide.
| Compound Name | 1-[2-[(2R)-1-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]piperidin-2-yl]ethyl]-N-propan-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 26341710 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 1-[2-[(2R)-1-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]piperidin-2-yl]ethyl]-N-propan-2-yltriazole-4-carboxamide |
| SMILES | COc1ccc(/C=C/C(=O)N2CCCC[C@@H]2CCn2cc(C(=O)NC(C)C)nn2)cc1 |
| InChI | InChI=1S/C23H31N5O3/c1-17(2)24-23(30)21-16-27(26-25-21)15-13-19-6-4-5-14-28(19)22(29)12-9-18-7-10-20(31-3)11-8-18/h7-12,16-17,19H,4-6,13-15H2,1-3H3,(H,24,30)/b12-9+/t19-/m1/s1 |
| InChIKey | VVLYAVNVXCRTBW-VSRDTVRMSA-N |
| XLogP | 2.91 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|