C9H13N3O3 — CID 129412512
methyl 1-[[(3R)-oxolan-3-yl]methyl]triazole-4-carboxylate (PubChem CID 129412512) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl 1-[[(3R)-oxolan-3-yl]methyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[[(3R)-oxolan-3-yl]methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 129412512 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | methyl 1-[[(3R)-oxolan-3-yl]methyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(C[C@H]2CCOC2)nn1 |
| InChI | InChI=1S/C9H13N3O3/c1-14-9(13)8-5-12(11-10-8)4-7-2-3-15-6-7/h5,7H,2-4,6H2,1H3/t7-/m1/s1 |
| InChIKey | HVKXQYYNOQEHNX-SSDOTTSWSA-N |
| XLogP | 0.10 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |