C20H25N7O — CID 98256590
1-(4-aminocyclohexyl)-N-[(1S)-2-imidazol-1-yl-1-phenylethyl]triazole-4-carboxamide (PubChem CID 98256590) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-N-[(1S)-2-imidazol-1-yl-1-phenylethyl]triazole-4-carboxamide.
| Compound Name | 1-(4-aminocyclohexyl)-N-[(1S)-2-imidazol-1-yl-1-phenylethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 98256590 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-(4-aminocyclohexyl)-N-[(1S)-2-imidazol-1-yl-1-phenylethyl]triazole-4-carboxamide |
| SMILES | NC1CCC(n2cc(C(=O)N[C@H](Cn3ccnc3)c3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C20H25N7O/c21-16-6-8-17(9-7-16)27-13-19(24-25-27)20(28)23-18(12-26-11-10-22-14-26)15-4-2-1-3-5-15/h1-5,10-11,13-14,16-18H,6-9,12,21H2,(H,23,28)/t16?,17?,18-/m1/s1 |
| InChIKey | OWPPZJKABVJJPZ-DAWZGUTISA-N |
| XLogP | 2.09 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |