C18H18FN5O2 — CID 25289510
1-[(2-fluorophenyl)methyl]-N-[(2S)-2-pyridin-3-yloxypropyl]triazole-4-carboxamide (PubChem CID 25289510) has the molecular formula C18H18FN5O2 and a molecular weight of 355.37 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-[(2S)-2-pyridin-3-yloxypropyl]triazole-4-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-[(2S)-2-pyridin-3-yloxypropyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 25289510 |
| Molecular Formula | C18H18FN5O2 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-[(2S)-2-pyridin-3-yloxypropyl]triazole-4-carboxamide |
| SMILES | C[C@@H](CNC(=O)c1cn(Cc2ccccc2F)nn1)Oc1cccnc1 |
| InChI | InChI=1S/C18H18FN5O2/c1-13(26-15-6-4-8-20-10-15)9-21-18(25)17-12-24(23-22-17)11-14-5-2-3-7-16(14)19/h2-8,10,12-13H,9,11H2,1H3,(H,21,25)/t13-/m0/s1 |
| InChIKey | BBBOATHMRWBCGS-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |