C13H22N4O3 — CID 106021479
2-[4-(octan-4-ylcarbamoyl)triazol-1-yl]acetic acid (PubChem CID 106021479) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[4-(octan-4-ylcarbamoyl)triazol-1-yl]acetic acid.
| Compound Name | 2-[4-(octan-4-ylcarbamoyl)triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 106021479 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-[4-(octan-4-ylcarbamoyl)triazol-1-yl]acetic acid |
| SMILES | CCCCC(CCC)NC(=O)c1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C13H22N4O3/c1-3-5-7-10(6-4-2)14-13(20)11-8-17(16-15-11)9-12(18)19/h8,10H,3-7,9H2,1-2H3,(H,14,20)(H,18,19) |
| InChIKey | KAJGOBIHQMGFGH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |