C11H18N4O3 — CID 66288728
2-[4-[methyl(pentyl)carbamoyl]triazol-1-yl]acetic acid (PubChem CID 66288728) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[4-[methyl(pentyl)carbamoyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[methyl(pentyl)carbamoyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 66288728 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 2-[4-[methyl(pentyl)carbamoyl]triazol-1-yl]acetic acid |
| SMILES | CCCCCN(C)C(=O)c1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C11H18N4O3/c1-3-4-5-6-14(2)11(18)9-7-15(13-12-9)8-10(16)17/h7H,3-6,8H2,1-2H3,(H,16,17) |
| InChIKey | SGVXUDUHWRKHLP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|