C11H12N4O3S — CID 66289790
2-[4-[methyl(thiophen-3-ylmethyl)carbamoyl]triazol-1-yl]acetic acid (PubChem CID 66289790) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is 2-[4-[methyl(thiophen-3-ylmethyl)carbamoyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[methyl(thiophen-3-ylmethyl)carbamoyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 66289790 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-[4-[methyl(thiophen-3-ylmethyl)carbamoyl]triazol-1-yl]acetic acid |
| SMILES | CN(Cc1ccsc1)C(=O)c1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C11H12N4O3S/c1-14(4-8-2-3-19-7-8)11(18)9-5-15(13-12-9)6-10(16)17/h2-3,5,7H,4,6H2,1H3,(H,16,17) |
| InChIKey | VEDZPNINUCAGKR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |