C10H16N4O3S — CID 114238096
2-[4-[methyl(3-methylsulfanylpropyl)carbamoyl]triazol-1-yl]acetic acid (PubChem CID 114238096) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[4-[methyl(3-methylsulfanylpropyl)carbamoyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[methyl(3-methylsulfanylpropyl)carbamoyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 114238096 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-[4-[methyl(3-methylsulfanylpropyl)carbamoyl]triazol-1-yl]acetic acid |
| SMILES | CSCCCN(C)C(=O)c1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C10H16N4O3S/c1-13(4-3-5-18-2)10(17)8-6-14(12-11-8)7-9(15)16/h6H,3-5,7H2,1-2H3,(H,15,16) |
| InChIKey | DBVRFOINRGQFHL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|