C16H22N4OS — CID 95722766
1-cyclohexyl-N-[(2S)-1-thiophen-3-ylpropan-2-yl]triazole-4-carboxamide (PubChem CID 95722766) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 1-cyclohexyl-N-[(2S)-1-thiophen-3-ylpropan-2-yl]triazole-4-carboxamide.
| Compound Name | 1-cyclohexyl-N-[(2S)-1-thiophen-3-ylpropan-2-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 95722766 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-cyclohexyl-N-[(2S)-1-thiophen-3-ylpropan-2-yl]triazole-4-carboxamide |
| SMILES | C[C@@H](Cc1ccsc1)NC(=O)c1cn(C2CCCCC2)nn1 |
| InChI | InChI=1S/C16H22N4OS/c1-12(9-13-7-8-22-11-13)17-16(21)15-10-20(19-18-15)14-5-3-2-4-6-14/h7-8,10-12,14H,2-6,9H2,1H3,(H,17,21)/t12-/m0/s1 |
| InChIKey | XFDPRWMYSFUOEW-LBPRGKRZSA-N |
| XLogP | 3.21 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |