C15H22ClN5OS — CID 119727861
N-[(5-ethylthiophen-2-yl)methyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119727861) has the molecular formula C15H22ClN5OS and a molecular weight of 355.90 g/mol. Its IUPAC name is N-[(5-ethylthiophen-2-yl)methyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[(5-ethylthiophen-2-yl)methyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119727861 |
| Molecular Formula | C15H22ClN5OS |
| Molecular Weight | 355.90 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[(5-ethylthiophen-2-yl)methyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CCc1ccc(CNC(=O)c2cn(C3CCNCC3)nn2)s1.Cl |
| InChI | InChI=1S/C15H21N5OS.ClH/c1-2-12-3-4-13(22-12)9-17-15(21)14-10-20(19-18-14)11-5-7-16-8-6-11;/h3-4,10-11,16H,2,5-9H2,1H3,(H,17,21);1H |
| InChIKey | NFLNIVWPDRYCEB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.90 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |