C12H16N6O2 — CID 81170009
N-(1,2-oxazol-3-ylmethyl)-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 81170009) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(1,2-oxazol-3-ylmethyl)-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 81170009 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | O=C(NCc1ccon1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C12H16N6O2/c19-12(14-7-9-3-6-20-16-9)11-8-18(17-15-11)10-1-4-13-5-2-10/h3,6,8,10,13H,1-2,4-5,7H2,(H,14,19) |
| InChIKey | MCTINYTWDMKTJV-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |