C10H15N9O — CID 63284483
1-piperidin-4-yl-N-(2H-tetrazol-5-ylmethyl)triazole-4-carboxamide (PubChem CID 63284483) has the molecular formula C10H15N9O and a molecular weight of 277.29 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-(2H-tetrazol-5-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-(2H-tetrazol-5-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 63284483 |
| Molecular Formula | C10H15N9O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 1-piperidin-4-yl-N-(2H-tetrazol-5-ylmethyl)triazole-4-carboxamide |
| SMILES | O=C(NCc1nn[nH]n1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C10H15N9O/c20-10(12-5-9-14-16-17-15-9)8-6-19(18-13-8)7-1-3-11-4-2-7/h6-7,11H,1-5H2,(H,12,20)(H,14,15,16,17) |
| InChIKey | KSLJQMUTLBLISO-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |