C13H22ClN5O — CID 119724139
N-(cyclobutylmethyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119724139) has the molecular formula C13H22ClN5O and a molecular weight of 299.81 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-(cyclobutylmethyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119724139 |
| Molecular Formula | C13H22ClN5O |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-(cyclobutylmethyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC1CCC1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C13H21N5O.ClH/c19-13(15-8-10-2-1-3-10)12-9-18(17-16-12)11-4-6-14-7-5-11;/h9-11,14H,1-8H2,(H,15,19);1H |
| InChIKey | ASWIOEGOIWGPDC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |