C17H23ClN6O2 — CID 119714079
N-[2-(ethylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119714079) has the molecular formula C17H23ClN6O2 and a molecular weight of 378.86 g/mol. Its IUPAC name is N-[2-(ethylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(ethylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119714079 |
| Molecular Formula | C17H23ClN6O2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[2-(ethylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CCNC(=O)c1ccccc1NC(=O)c1cn(C2CCNCC2)nn1.Cl |
| InChI | InChI=1S/C17H22N6O2.ClH/c1-2-19-16(24)13-5-3-4-6-14(13)20-17(25)15-11-23(22-21-15)12-7-9-18-10-8-12;/h3-6,11-12,18H,2,7-10H2,1H3,(H,19,24)(H,20,25);1H |
| InChIKey | YXKMRYNLKNOPFR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |