C19H26N6O2 — CID 119707297
N-[2-(tert-butylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119707297) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[2-(tert-butylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[2-(tert-butylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119707297 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | N-[2-(tert-butylcarbamoyl)phenyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1ccccc1NC(=O)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C19H26N6O2/c1-19(2,3)22-17(26)14-6-4-5-7-15(14)21-18(27)16-12-25(24-23-16)13-8-10-20-11-9-13/h4-7,12-13,20H,8-11H2,1-3H3,(H,21,27)(H,22,26) |
| InChIKey | XVZWRNYBCXVZCX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |