C14H14F3N5O — CID 119707993
1-piperidin-4-yl-N-(3,4,5-trifluorophenyl)triazole-4-carboxamide (PubChem CID 119707993) has the molecular formula C14H14F3N5O and a molecular weight of 325.29 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-(3,4,5-trifluorophenyl)triazole-4-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-(3,4,5-trifluorophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 119707993 |
| Molecular Formula | C14H14F3N5O |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 1-piperidin-4-yl-N-(3,4,5-trifluorophenyl)triazole-4-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C14H14F3N5O/c15-10-5-8(6-11(16)13(10)17)19-14(23)12-7-22(21-20-12)9-1-3-18-4-2-9/h5-7,9,18H,1-4H2,(H,19,23) |
| InChIKey | NDMVCRMLWFEWCR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|