C17H25ClN6O3S — CID 119685721
1-piperidin-4-yl-N-[4-(propan-2-ylsulfamoyl)phenyl]triazole-4-carboxamide;hydrochloride (PubChem CID 119685721) has the molecular formula C17H25ClN6O3S and a molecular weight of 428.95 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-[4-(propan-2-ylsulfamoyl)phenyl]triazole-4-carboxamide;hydrochloride.
| Compound Name | 1-piperidin-4-yl-N-[4-(propan-2-ylsulfamoyl)phenyl]triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119685721 |
| Molecular Formula | C17H25ClN6O3S |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1-piperidin-4-yl-N-[4-(propan-2-ylsulfamoyl)phenyl]triazole-4-carboxamide;hydrochloride |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NC(=O)c2cn(C3CCNCC3)nn2)cc1.Cl |
| InChI | InChI=1S/C17H24N6O3S.ClH/c1-12(2)21-27(25,26)15-5-3-13(4-6-15)19-17(24)16-11-23(22-20-16)14-7-9-18-10-8-14;/h3-6,11-12,14,18,21H,7-10H2,1-2H3,(H,19,24);1H |
| InChIKey | KSTGCEHYKLFYAX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |