C19H19FN6O2 — CID 119849080
N-[6-(4-fluorophenoxy)-3-pyridinyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119849080) has the molecular formula C19H19FN6O2 and a molecular weight of 382.40 g/mol. Its IUPAC name is N-[6-(4-fluorophenoxy)-3-pyridinyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[6-(4-fluorophenoxy)-3-pyridinyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119849080 |
| Molecular Formula | C19H19FN6O2 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[6-(4-fluorophenoxy)-3-pyridinyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccc(F)cc2)nc1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C19H19FN6O2/c20-13-1-4-16(5-2-13)28-18-6-3-14(11-22-18)23-19(27)17-12-26(25-24-17)15-7-9-21-10-8-15/h1-6,11-12,15,21H,7-10H2,(H,23,27) |
| InChIKey | GHWBAJIBBMPIHG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |