C20H21N7O2 — CID 119844777
1-piperidin-4-yl-N-[4-(pyridin-3-ylcarbamoyl)phenyl]triazole-4-carboxamide (PubChem CID 119844777) has the molecular formula C20H21N7O2 and a molecular weight of 391.44 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-[4-(pyridin-3-ylcarbamoyl)phenyl]triazole-4-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-[4-(pyridin-3-ylcarbamoyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 119844777 |
| Molecular Formula | C20H21N7O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-piperidin-4-yl-N-[4-(pyridin-3-ylcarbamoyl)phenyl]triazole-4-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1ccc(NC(=O)c2cn(C3CCNCC3)nn2)cc1 |
| InChI | InChI=1S/C20H21N7O2/c28-19(24-16-2-1-9-22-12-16)14-3-5-15(6-4-14)23-20(29)18-13-27(26-25-18)17-7-10-21-11-8-17/h1-6,9,12-13,17,21H,7-8,10-11H2,(H,23,29)(H,24,28) |
| InChIKey | AFSAJFBGOLTQHA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |