C20H26Cl2N8O — CID 119883333
1-piperidin-4-yl-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]triazole-4-carboxamide;dihydrochloride (PubChem CID 119883333) has the molecular formula C20H26Cl2N8O and a molecular weight of 465.39 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]triazole-4-carboxamide;dihydrochloride.
| Compound Name | 1-piperidin-4-yl-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]triazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119883333 |
| Molecular Formula | C20H26Cl2N8O |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-piperidin-4-yl-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]triazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccc(-c2nnc3n2CCCC3)cc1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C20H24N8O.2ClH/c29-20(17-13-28(26-23-17)16-8-10-21-11-9-16)22-15-6-4-14(5-7-15)19-25-24-18-3-1-2-12-27(18)19;;/h4-7,13,16,21H,1-3,8-12H2,(H,22,29);2*1H |
| InChIKey | SJAXBPDHMUESAR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |