C17H24ClN5O3 — CID 119688375
N-(4-ethoxy-3-methoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119688375) has the molecular formula C17H24ClN5O3 and a molecular weight of 381.86 g/mol. Its IUPAC name is N-(4-ethoxy-3-methoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-(4-ethoxy-3-methoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119688375 |
| Molecular Formula | C17H24ClN5O3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-(4-ethoxy-3-methoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CCOc1ccc(NC(=O)c2cn(C3CCNCC3)nn2)cc1OC.Cl |
| InChI | InChI=1S/C17H23N5O3.ClH/c1-3-25-15-5-4-12(10-16(15)24-2)19-17(23)14-11-22(21-20-14)13-6-8-18-9-7-13;/h4-5,10-11,13,18H,3,6-9H2,1-2H3,(H,19,23);1H |
| InChIKey | RIGMKKYEOAEWEH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |