C16H21BrClN5O2 — CID 119812500
N-(4-bromo-2-ethoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119812500) has the molecular formula C16H21BrClN5O2 and a molecular weight of 430.73 g/mol. Its IUPAC name is N-(4-bromo-2-ethoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-(4-bromo-2-ethoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119812500 |
| Molecular Formula | C16H21BrClN5O2 |
| Molecular Weight | 430.73 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | N-(4-bromo-2-ethoxyphenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CCOc1cc(Br)ccc1NC(=O)c1cn(C2CCNCC2)nn1.Cl |
| InChI | InChI=1S/C16H20BrN5O2.ClH/c1-2-24-15-9-11(17)3-4-13(15)19-16(23)14-10-22(21-20-14)12-5-7-18-8-6-12;/h3-4,9-10,12,18H,2,5-8H2,1H3,(H,19,23);1H |
| InChIKey | LCBUEAQARIHWAT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.73 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |