C20H26FN5O — CID 119810342
N-[cyclopentyl-(3-fluorophenyl)methyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119810342) has the molecular formula C20H26FN5O and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[cyclopentyl-(3-fluorophenyl)methyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[cyclopentyl-(3-fluorophenyl)methyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119810342 |
| Molecular Formula | C20H26FN5O |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | N-[cyclopentyl-(3-fluorophenyl)methyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | O=C(NC(c1cccc(F)c1)C1CCCC1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C20H26FN5O/c21-16-7-3-6-15(12-16)19(14-4-1-2-5-14)23-20(27)18-13-26(25-24-18)17-8-10-22-11-9-17/h3,6-7,12-14,17,19,22H,1-2,4-5,8-11H2,(H,23,27) |
| InChIKey | LBUVAFKKIGTQPO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |