C17H20ClN3O3S — CID 52502640
1-[(1S)-1-(4-chlorophenyl)ethyl]-3-[3-(dimethylsulfamoyl)phenyl]urea (PubChem CID 52502640) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-[3-(dimethylsulfamoyl)phenyl]urea.
| Compound Name | 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-[3-(dimethylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 52502640 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-[3-(dimethylsulfamoyl)phenyl]urea |
| SMILES | C[C@H](NC(=O)Nc1cccc(S(=O)(=O)N(C)C)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClN3O3S/c1-12(13-7-9-14(18)10-8-13)19-17(22)20-15-5-4-6-16(11-15)25(23,24)21(2)3/h4-12H,1-3H3,(H2,19,20,22)/t12-/m0/s1 |
| InChIKey | WGPXJQKIJAWGKI-LBPRGKRZSA-N |
| XLogP | 3.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |