C17H20FN3O2S2 — CID 8680921
3-[3-(dimethylsulfamoyl)phenyl]-1-[(3-fluorophenyl)methyl]-1-methylthiourea (PubChem CID 8680921) has the molecular formula C17H20FN3O2S2 and a molecular weight of 381.50 g/mol. Its IUPAC name is 3-[3-(dimethylsulfamoyl)phenyl]-1-[(3-fluorophenyl)methyl]-1-methylthiourea.
| Compound Name | 3-[3-(dimethylsulfamoyl)phenyl]-1-[(3-fluorophenyl)methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 8680921 |
| Molecular Formula | C17H20FN3O2S2 |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 3-[3-(dimethylsulfamoyl)phenyl]-1-[(3-fluorophenyl)methyl]-1-methylthiourea |
| SMILES | CN(Cc1cccc(F)c1)C(=S)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C17H20FN3O2S2/c1-20(2)25(22,23)16-9-5-8-15(11-16)19-17(24)21(3)12-13-6-4-7-14(18)10-13/h4-11H,12H2,1-3H3,(H,19,24) |
| InChIKey | HWVJXELIQVNNIO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|