C23H25ClF3N3O3 — CID 43913391
3-butan-2-yloxy-N-[3-chloro-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 43913391) has the molecular formula C23H25ClF3N3O3 and a molecular weight of 483.92 g/mol. Its IUPAC name is 3-butan-2-yloxy-N-[3-chloro-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3-butan-2-yloxy-N-[3-chloro-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 43913391 |
| Molecular Formula | C23H25ClF3N3O3 |
| Molecular Weight | 483.92 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 3-butan-2-yloxy-N-[3-chloro-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | CCC(C)Oc1cccc(C(=O)Nc2ccc(N3CCN(C(=O)C(F)(F)F)CC3)c(Cl)c2)c1 |
| InChI | InChI=1S/C23H25ClF3N3O3/c1-3-15(2)33-18-6-4-5-16(13-18)21(31)28-17-7-8-20(19(24)14-17)29-9-11-30(12-10-29)22(32)23(25,26)27/h4-8,13-15H,3,9-12H2,1-2H3,(H,28,31) |
| InChIKey | FFNCWKHFJHPTHL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.92 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|