C19H26N6O2 — CID 47076572
1-(3-methyl-2-pyridinyl)-3-[1-[(3-methyl-2-pyridinyl)carbamoylamino]pentan-3-yl]urea (PubChem CID 47076572) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 1-(3-methyl-2-pyridinyl)-3-[1-[(3-methyl-2-pyridinyl)carbamoylamino]pentan-3-yl]urea.
| Compound Name | 1-(3-methyl-2-pyridinyl)-3-[1-[(3-methyl-2-pyridinyl)carbamoylamino]pentan-3-yl]urea |
|---|---|
| PubChem CID | 47076572 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-(3-methyl-2-pyridinyl)-3-[1-[(3-methyl-2-pyridinyl)carbamoylamino]pentan-3-yl]urea |
| SMILES | CCC(CCNC(=O)Nc1ncccc1C)NC(=O)Nc1ncccc1C |
| InChI | InChI=1S/C19H26N6O2/c1-4-15(23-19(27)25-17-14(3)8-6-11-21-17)9-12-22-18(26)24-16-13(2)7-5-10-20-16/h5-8,10-11,15H,4,9,12H2,1-3H3,(H2,20,22,24,26)(H2,21,23,25,27) |
| InChIKey | SZYBSUHMVRNPJF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |