C12H13N3OS — CID 47236047
1-(3-methyl-2-pyridinyl)-3-(thiophen-2-ylmethyl)urea (PubChem CID 47236047) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 1-(3-methyl-2-pyridinyl)-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-(3-methyl-2-pyridinyl)-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 47236047 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-(3-methyl-2-pyridinyl)-3-(thiophen-2-ylmethyl)urea |
| SMILES | Cc1cccnc1NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C12H13N3OS/c1-9-4-2-6-13-11(9)15-12(16)14-8-10-5-3-7-17-10/h2-7H,8H2,1H3,(H2,13,14,15,16) |
| InChIKey | AWROITUGPSOCKV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |