C17H16N4OS2 — CID 60620217
1-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)-3-(thiophen-2-ylmethyl)urea (PubChem CID 60620217) has the molecular formula C17H16N4OS2 and a molecular weight of 356.48 g/mol. Its IUPAC name is 1-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 60620217 |
| Molecular Formula | C17H16N4OS2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 1-(2-methyl-4-pyrimidin-2-ylsulfanylphenyl)-3-(thiophen-2-ylmethyl)urea |
| SMILES | Cc1cc(Sc2ncccn2)ccc1NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C17H16N4OS2/c1-12-10-13(24-17-18-7-3-8-19-17)5-6-15(12)21-16(22)20-11-14-4-2-9-23-14/h2-10H,11H2,1H3,(H2,20,21,22) |
| InChIKey | HCNZRKQJNUKGDW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |