C14H16ClFN2O3S2 — CID 146080792
N'-(3-chloro-4-fluorophenyl)-N-[(6-hydroxy-1,4-dithiepan-6-yl)methyl]oxamide (PubChem CID 146080792) has the molecular formula C14H16ClFN2O3S2 and a molecular weight of 378.88 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-[(6-hydroxy-1,4-dithiepan-6-yl)methyl]oxamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-[(6-hydroxy-1,4-dithiepan-6-yl)methyl]oxamide |
|---|---|
| PubChem CID | 146080792 |
| Molecular Formula | C14H16ClFN2O3S2 |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-[(6-hydroxy-1,4-dithiepan-6-yl)methyl]oxamide |
| SMILES | O=C(NCC1(O)CSCCSC1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClFN2O3S2/c15-10-5-9(1-2-11(10)16)18-13(20)12(19)17-6-14(21)7-22-3-4-23-8-14/h1-2,5,21H,3-4,6-8H2,(H,17,19)(H,18,20) |
| InChIKey | NNRQVDFKRWFWGR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|