C14H16ClFN2O3 — CID 111435524
N'-(5-chloro-2-fluorophenyl)-N-[(1-hydroxycyclopentyl)methyl]oxamide (PubChem CID 111435524) has the molecular formula C14H16ClFN2O3 and a molecular weight of 314.74 g/mol. Its IUPAC name is N'-(5-chloro-2-fluorophenyl)-N-[(1-hydroxycyclopentyl)methyl]oxamide.
| Compound Name | N'-(5-chloro-2-fluorophenyl)-N-[(1-hydroxycyclopentyl)methyl]oxamide |
|---|---|
| PubChem CID | 111435524 |
| Molecular Formula | C14H16ClFN2O3 |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | N'-(5-chloro-2-fluorophenyl)-N-[(1-hydroxycyclopentyl)methyl]oxamide |
| SMILES | O=C(NCC1(O)CCCC1)C(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C14H16ClFN2O3/c15-9-3-4-10(16)11(7-9)18-13(20)12(19)17-8-14(21)5-1-2-6-14/h3-4,7,21H,1-2,5-6,8H2,(H,17,19)(H,18,20) |
| InChIKey | OOZBUGLVKWOIQG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|