C20H18ClN3O3 — CID 90581320
N'-(5-chloro-2-cyanophenyl)-N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]oxamide (PubChem CID 90581320) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is N'-(5-chloro-2-cyanophenyl)-N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]oxamide.
| Compound Name | N'-(5-chloro-2-cyanophenyl)-N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]oxamide |
|---|---|
| PubChem CID | 90581320 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N'-(5-chloro-2-cyanophenyl)-N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]oxamide |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)C(=O)NCC1(O)CCc2ccccc2C1 |
| InChI | InChI=1S/C20H18ClN3O3/c21-16-6-5-15(11-22)17(9-16)24-19(26)18(25)23-12-20(27)8-7-13-3-1-2-4-14(13)10-20/h1-6,9,27H,7-8,10,12H2,(H,23,25)(H,24,26) |
| InChIKey | VNYKRIJELTUPFD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|