C21H22ClN3O3S — CID 121179274
N'-(5-chloro-2-cyanophenyl)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]oxamide (PubChem CID 121179274) has the molecular formula C21H22ClN3O3S and a molecular weight of 431.95 g/mol. Its IUPAC name is N'-(5-chloro-2-cyanophenyl)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]oxamide.
| Compound Name | N'-(5-chloro-2-cyanophenyl)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]oxamide |
|---|---|
| PubChem CID | 121179274 |
| Molecular Formula | C21H22ClN3O3S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N'-(5-chloro-2-cyanophenyl)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]oxamide |
| SMILES | CC(O)c1ccc(C2(CNC(=O)C(=O)Nc3cc(Cl)ccc3C#N)CCCC2)s1 |
| InChI | InChI=1S/C21H22ClN3O3S/c1-13(26)17-6-7-18(29-17)21(8-2-3-9-21)12-24-19(27)20(28)25-16-10-15(22)5-4-14(16)11-23/h4-7,10,13,26H,2-3,8-9,12H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | MAHNLACVMWYKSY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|