C16H18ClFN2O4 — CID 7423776
N'-(3-chloro-4-fluorophenyl)-N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]oxamide (PubChem CID 7423776) has the molecular formula C16H18ClFN2O4 and a molecular weight of 356.78 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]oxamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]oxamide |
|---|---|
| PubChem CID | 7423776 |
| Molecular Formula | C16H18ClFN2O4 |
| Molecular Weight | 356.78 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-[[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]oxamide |
| SMILES | O=C(NC[C@@H]1COC2(CCCC2)O1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H18ClFN2O4/c17-12-7-10(3-4-13(12)18)20-15(22)14(21)19-8-11-9-23-16(24-11)5-1-2-6-16/h3-4,7,11H,1-2,5-6,8-9H2,(H,19,21)(H,20,22)/t11-/m1/s1 |
| InChIKey | WTZJKTZZMNOMGW-LLVKDONJSA-N |
| XLogP | 2.22 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.78 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|