C18H17F2N3O4 — CID 55868228
N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(N-ethyl-3,4-difluoroanilino)acetamide (PubChem CID 55868228) has the molecular formula C18H17F2N3O4 and a molecular weight of 377.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(N-ethyl-3,4-difluoroanilino)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(N-ethyl-3,4-difluoroanilino)acetamide |
|---|---|
| PubChem CID | 55868228 |
| Molecular Formula | C18H17F2N3O4 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(N-ethyl-3,4-difluoroanilino)acetamide |
| SMILES | CCN(CC(=O)NC(=O)Nc1ccc2c(c1)OCO2)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H17F2N3O4/c1-2-23(12-4-5-13(19)14(20)8-12)9-17(24)22-18(25)21-11-3-6-15-16(7-11)27-10-26-15/h3-8H,2,9-10H2,1H3,(H2,21,22,24,25) |
| InChIKey | CEAOUMDOSXECCU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |