C18H25N3O4 — CID 18127481
N-(1,3-benzodioxol-5-ylcarbamoyl)-2-[cycloheptyl(methyl)amino]acetamide (PubChem CID 18127481) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylcarbamoyl)-2-[cycloheptyl(methyl)amino]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-2-[cycloheptyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 18127481 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-2-[cycloheptyl(methyl)amino]acetamide |
| SMILES | CN(CC(=O)NC(=O)Nc1ccc2c(c1)OCO2)C1CCCCCC1 |
| InChI | InChI=1S/C18H25N3O4/c1-21(14-6-4-2-3-5-7-14)11-17(22)20-18(23)19-13-8-9-15-16(10-13)25-12-24-15/h8-10,14H,2-7,11-12H2,1H3,(H2,19,20,22,23) |
| InChIKey | XXBKPLYQASLLSV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |