C17H16F2N2O3 — CID 109022867
3-(1,3-benzodioxol-5-ylmethylamino)-N-(3,4-difluorophenyl)propanamide (PubChem CID 109022867) has the molecular formula C17H16F2N2O3 and a molecular weight of 334.32 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylamino)-N-(3,4-difluorophenyl)propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylamino)-N-(3,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 109022867 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylamino)-N-(3,4-difluorophenyl)propanamide |
| SMILES | O=C(CCNCc1ccc2c(c1)OCO2)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H16F2N2O3/c18-13-3-2-12(8-14(13)19)21-17(22)5-6-20-9-11-1-4-15-16(7-11)24-10-23-15/h1-4,7-8,20H,5-6,9-10H2,(H,21,22) |
| InChIKey | LYZNDSISVRCLKI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|