C16H13F2NO3S — CID 9042684
N-(1,3-benzodioxol-5-yl)-3-(3,4-difluorophenyl)sulfanylpropanamide (PubChem CID 9042684) has the molecular formula C16H13F2NO3S and a molecular weight of 337.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-(3,4-difluorophenyl)sulfanylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-(3,4-difluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 9042684 |
| Molecular Formula | C16H13F2NO3S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-(3,4-difluorophenyl)sulfanylpropanamide |
| SMILES | O=C(CCSc1ccc(F)c(F)c1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13F2NO3S/c17-12-3-2-11(8-13(12)18)23-6-5-16(20)19-10-1-4-14-15(7-10)22-9-21-14/h1-4,7-8H,5-6,9H2,(H,19,20) |
| InChIKey | BNLKPICQILGQAI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |