C16H14BrNO3S — CID 52558754
N-(1,3-benzodioxol-5-yl)-3-(4-bromophenyl)sulfanylpropanamide (PubChem CID 52558754) has the molecular formula C16H14BrNO3S and a molecular weight of 380.26 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-(4-bromophenyl)sulfanylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-(4-bromophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 52558754 |
| Molecular Formula | C16H14BrNO3S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-(4-bromophenyl)sulfanylpropanamide |
| SMILES | O=C(CCSc1ccc(Br)cc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14BrNO3S/c17-11-1-4-13(5-2-11)22-8-7-16(19)18-12-3-6-14-15(9-12)21-10-20-14/h1-6,9H,7-8,10H2,(H,18,19) |
| InChIKey | VFBOIQORFXDLJJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |