C19H20N6O3 — CID 50776826
4-methoxy-N-[2-morpholin-4-yl-5-(tetrazol-1-yl)phenyl]benzamide (PubChem CID 50776826) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 4-methoxy-N-[2-morpholin-4-yl-5-(tetrazol-1-yl)phenyl]benzamide.
| Compound Name | 4-methoxy-N-[2-morpholin-4-yl-5-(tetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 50776826 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 4-methoxy-N-[2-morpholin-4-yl-5-(tetrazol-1-yl)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(-n3cnnn3)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H20N6O3/c1-27-16-5-2-14(3-6-16)19(26)21-17-12-15(25-13-20-22-23-25)4-7-18(17)24-8-10-28-11-9-24/h2-7,12-13H,8-11H2,1H3,(H,21,26) |
| InChIKey | AZXCWEVMFYMSDA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|