C20H19F3N6O2 — CID 55616983
3-methyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-4-(tetrazol-1-yl)benzamide (PubChem CID 55616983) has the molecular formula C20H19F3N6O2 and a molecular weight of 432.41 g/mol. Its IUPAC name is 3-methyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-4-(tetrazol-1-yl)benzamide.
| Compound Name | 3-methyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55616983 |
| Molecular Formula | C20H19F3N6O2 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-methyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-4-(tetrazol-1-yl)benzamide |
| SMILES | Cc1cc(C(=O)Nc2cc(C(F)(F)F)ccc2N2CCOCC2)ccc1-n1cnnn1 |
| InChI | InChI=1S/C20H19F3N6O2/c1-13-10-14(2-4-17(13)29-12-24-26-27-29)19(30)25-16-11-15(20(21,22)23)3-5-18(16)28-6-8-31-9-7-28/h2-5,10-12H,6-9H2,1H3,(H,25,30) |
| InChIKey | ODJVLKOUVZQWDQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |