C17H17Cl2N3O2 — CID 50881482
N-(4-amino-2-chloro-5-morpholin-4-ylphenyl)-4-chlorobenzamide (PubChem CID 50881482) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N-(4-amino-2-chloro-5-morpholin-4-ylphenyl)-4-chlorobenzamide.
| Compound Name | N-(4-amino-2-chloro-5-morpholin-4-ylphenyl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 50881482 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-(4-amino-2-chloro-5-morpholin-4-ylphenyl)-4-chlorobenzamide |
| SMILES | Nc1cc(Cl)c(NC(=O)c2ccc(Cl)cc2)cc1N1CCOCC1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c18-12-3-1-11(2-4-12)17(23)21-15-10-16(14(20)9-13(15)19)22-5-7-24-8-6-22/h1-4,9-10H,5-8,20H2,(H,21,23) |
| InChIKey | IJCOSWGVGXQVGT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|