C19H23N3O4 — CID 168568582
dimethyl (E)-2-[3-cyano-4-(3-methylpiperidin-1-yl)anilino]but-2-enedioate (PubChem CID 168568582) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is dimethyl (E)-2-[3-cyano-4-(3-methylpiperidin-1-yl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-cyano-4-(3-methylpiperidin-1-yl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568582 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | dimethyl (E)-2-[3-cyano-4-(3-methylpiperidin-1-yl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(N2CCCC(C)C2)c(C#N)c1)C(=O)OC |
| InChI | InChI=1S/C19H23N3O4/c1-13-5-4-8-22(12-13)17-7-6-15(9-14(17)11-20)21-16(19(24)26-3)10-18(23)25-2/h6-7,9-10,13,21H,4-5,8,12H2,1-3H3/b16-10+ |
| InChIKey | YUSNBQIIFOABTK-MHWRWJLKSA-N |
| XLogP | 2.44 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|