C12H17FN2OS — CID 169358959
[4-(2,2-dimethylpropoxy)-3-fluorophenyl]thiourea (PubChem CID 169358959) has the molecular formula C12H17FN2OS and a molecular weight of 256.35 g/mol. Its IUPAC name is [4-(2,2-dimethylpropoxy)-3-fluorophenyl]thiourea.
| Compound Name | [4-(2,2-dimethylpropoxy)-3-fluorophenyl]thiourea |
|---|---|
| PubChem CID | 169358959 |
| Molecular Formula | C12H17FN2OS |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | [4-(2,2-dimethylpropoxy)-3-fluorophenyl]thiourea |
| SMILES | CC(C)(C)COc1ccc(NC(N)=S)cc1F |
| InChI | InChI=1S/C12H17FN2OS/c1-12(2,3)7-16-10-5-4-8(6-9(10)13)15-11(14)17/h4-6H,7H2,1-3H3,(H3,14,15,17) |
| InChIKey | MJVLMFAVOLTBJS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|