C12H12ClFN4OS — CID 169359371
[4-[2-(4-chloropyrazol-1-yl)ethoxy]-3-fluorophenyl]thiourea (PubChem CID 169359371) has the molecular formula C12H12ClFN4OS and a molecular weight of 314.77 g/mol. Its IUPAC name is [4-[2-(4-chloropyrazol-1-yl)ethoxy]-3-fluorophenyl]thiourea.
| Compound Name | [4-[2-(4-chloropyrazol-1-yl)ethoxy]-3-fluorophenyl]thiourea |
|---|---|
| PubChem CID | 169359371 |
| Molecular Formula | C12H12ClFN4OS |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | [4-[2-(4-chloropyrazol-1-yl)ethoxy]-3-fluorophenyl]thiourea |
| SMILES | NC(=S)Nc1ccc(OCCn2cc(Cl)cn2)c(F)c1 |
| InChI | InChI=1S/C12H12ClFN4OS/c13-8-6-16-18(7-8)3-4-19-11-2-1-9(5-10(11)14)17-12(15)20/h1-2,5-7H,3-4H2,(H3,15,17,20) |
| InChIKey | OGOGMZNYRWZEPK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|